About ethyl 3-hydroxy-4-(5-oxo-1,4-diazepan-1-yl)butanoate
ethyl 3-hydroxy-4-(5-oxo-1,4-diazepan-1-yl)butanoate (PubChem CID 82768810) has the molecular formula C11H20N2O4
and a molecular weight of 244.29 g/mol. Its IUPAC name is ethyl 3-hydroxy-4-(5-oxo-1,4-diazepan-1-yl)butanoate.
Molecular Properties
| Compound Name | ethyl 3-hydroxy-4-(5-oxo-1,4-diazepan-1-yl)butanoate |
| PubChem CID | 82768810 |
| Molecular Formula | C11H20N2O4 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | ethyl 3-hydroxy-4-(5-oxo-1,4-diazepan-1-yl)butanoate |
| SMILES | CCOC(=O)CC(O)CN1CCNC(=O)CC1 |
| InChI | InChI=1S/C11H20N2O4/c1-2-17-11(16)7-9(14)8-13-5-3-10(15)12-4-6-13/h9,14H,2-8H2,1H3,(H,12,15) |
| InChIKey | WCODEZOCYHYVCS-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 3-hydroxy-4-(5-oxo-1,4-diazepan-1-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-hydroxy-4-(5-oxo-1,4-diazepan-1-yl)butanoate?
The IUPAC name of ethyl 3-hydroxy-4-(5-oxo-1,4-diazepan-1-yl)butanoate (CID 82768810) is ethyl 3-hydroxy-4-(5-oxo-1,4-diazepan-1-yl)butanoate.
What is the SMILES notation for ethyl 3-hydroxy-4-(5-oxo-1,4-diazepan-1-yl)butanoate?
The canonical SMILES for ethyl 3-hydroxy-4-(5-oxo-1,4-diazepan-1-yl)butanoate is CCOC(=O)CC(O)CN1CCNC(=O)CC1.
What is the InChIKey of ethyl 3-hydroxy-4-(5-oxo-1,4-diazepan-1-yl)butanoate?
The InChIKey is WCODEZOCYHYVCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O4/c1-2-17-11(16)7-9(14)8-13-5-3-10(15)12-4-6-13/h9,14H,2-8H2,1H3,(H,12,15).
What are the key properties of ethyl 3-hydroxy-4-(5-oxo-1,4-diazepan-1-yl)butanoate?
ethyl 3-hydroxy-4-(5-oxo-1,4-diazepan-1-yl)butanoate has a molecular weight of 244.29 g/mol, XLogP of -0.88, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-hydroxy-4-(5-oxo-1,4-diazepan-1-yl)butanoate is sourced from PubChem (CID 82768810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).