C9H17N3OS — CID 63003036
2-methyl-3-(5-oxo-1,4-diazepan-1-yl)propanethioamide (PubChem CID 63003036) has the molecular formula C9H17N3OS and a molecular weight of 215.32 g/mol. Its IUPAC name is 2-methyl-3-(5-oxo-1,4-diazepan-1-yl)propanethioamide.
| Compound Name | 2-methyl-3-(5-oxo-1,4-diazepan-1-yl)propanethioamide |
|---|---|
| PubChem CID | 63003036 |
| Molecular Formula | C9H17N3OS |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 2-methyl-3-(5-oxo-1,4-diazepan-1-yl)propanethioamide |
| SMILES | CC(CN1CCNC(=O)CC1)C(N)=S |
| InChI | InChI=1S/C9H17N3OS/c1-7(9(10)14)6-12-4-2-8(13)11-3-5-12/h7H,2-6H2,1H3,(H2,10,14)(H,11,13) |
| InChIKey | KZXBRDPHRBKHEN-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|