C13H19N3O — CID 63771217
1-(2-amino-2-phenylethyl)-1,4-diazepan-5-one (PubChem CID 63771217) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is 1-(2-amino-2-phenylethyl)-1,4-diazepan-5-one.
| Compound Name | 1-(2-amino-2-phenylethyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 63771217 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 1-(2-amino-2-phenylethyl)-1,4-diazepan-5-one |
| SMILES | NC(CN1CCNC(=O)CC1)c1ccccc1 |
| InChI | InChI=1S/C13H19N3O/c14-12(11-4-2-1-3-5-11)10-16-8-6-13(17)15-7-9-16/h1-5,12H,6-10,14H2,(H,15,17) |
| InChIKey | NVJMOMAHECVPBP-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |