C18H28N4O2 — CID 91058737
1-benzyl-1,4-diazepan-5-one;1-methyl-1,4-diazepan-5-one (PubChem CID 91058737) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is 1-benzyl-1,4-diazepan-5-one;1-methyl-1,4-diazepan-5-one.
| Compound Name | 1-benzyl-1,4-diazepan-5-one;1-methyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 91058737 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | 1-benzyl-1,4-diazepan-5-one;1-methyl-1,4-diazepan-5-one |
| SMILES | CN1CCNC(=O)CC1.O=C1CCN(Cc2ccccc2)CCN1 |
| InChI | InChI=1S/C12H16N2O.C6H12N2O/c15-12-6-8-14(9-7-13-12)10-11-4-2-1-3-5-11;1-8-4-2-6(9)7-3-5-8/h1-5H,6-10H2,(H,13,15);2-5H2,1H3,(H,7,9) |
| InChIKey | OTPFEZYMPGJYRH-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |