C25H34N4O4S — CID 10929024
4,14-dibenzyl-1,1-dioxo-1λ6-thia-4,7,11,14-tetrazacyclohexadecane-8,10-dione (PubChem CID 10929024) has the molecular formula C25H34N4O4S and a molecular weight of 486.64 g/mol. Its IUPAC name is 4,14-dibenzyl-1,1-dioxo-1λ6-thia-4,7,11,14-tetrazacyclohexadecane-8,10-dione.
| Compound Name | 4,14-dibenzyl-1,1-dioxo-1λ6-thia-4,7,11,14-tetrazacyclohexadecane-8,10-dione |
|---|---|
| PubChem CID | 10929024 |
| Molecular Formula | C25H34N4O4S |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | 4,14-dibenzyl-1,1-dioxo-1λ6-thia-4,7,11,14-tetrazacyclohexadecane-8,10-dione |
| SMILES | O=C1CC(=O)NCCN(Cc2ccccc2)CCS(=O)(=O)CCN(Cc2ccccc2)CCN1 |
| InChI | InChI=1S/C25H34N4O4S/c30-24-19-25(31)27-12-14-29(21-23-9-5-2-6-10-23)16-18-34(32,33)17-15-28(13-11-26-24)20-22-7-3-1-4-8-22/h1-10H,11-21H2,(H,26,30)(H,27,31) |
| InChIKey | ZVCNZOHULOZUNJ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|