C27H36N4O4 — CID 11518621
(1S,14S)-6,9-dibenzyl-16,16-dimethyl-15,17-dioxa-3,6,9,12-tetrazabicyclo[12.3.0]heptadecane-2,13-dione (PubChem CID 11518621) has the molecular formula C27H36N4O4 and a molecular weight of 480.61 g/mol. Its IUPAC name is (1S,14S)-6,9-dibenzyl-16,16-dimethyl-15,17-dioxa-3,6,9,12-tetrazabicyclo[12.3.0]heptadecane-2,13-dione.
| Compound Name | (1S,14S)-6,9-dibenzyl-16,16-dimethyl-15,17-dioxa-3,6,9,12-tetrazabicyclo[12.3.0]heptadecane-2,13-dione |
|---|---|
| PubChem CID | 11518621 |
| Molecular Formula | C27H36N4O4 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | (1S,14S)-6,9-dibenzyl-16,16-dimethyl-15,17-dioxa-3,6,9,12-tetrazabicyclo[12.3.0]heptadecane-2,13-dione |
| SMILES | CC1(C)O[C@@H]2C(=O)NCCN(Cc3ccccc3)CCN(Cc3ccccc3)CCNC(=O)[C@H]2O1 |
| InChI | InChI=1S/C27H36N4O4/c1-27(2)34-23-24(35-27)26(33)29-14-16-31(20-22-11-7-4-8-12-22)18-17-30(15-13-28-25(23)32)19-21-9-5-3-6-10-21/h3-12,23-24H,13-20H2,1-2H3,(H,28,32)(H,29,33)/t23-,24-/m0/s1 |
| InChIKey | NCGSLUZXFFFMMF-ZEQRLZLVSA-N |
| XLogP | 1.76 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |