C17H25N3O4 — CID 10088312
10-benzyl-1,4-dioxa-7,10,13-triazacyclopentadecane-6,14-dione (PubChem CID 10088312) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is 10-benzyl-1,4-dioxa-7,10,13-triazacyclopentadecane-6,14-dione.
| Compound Name | 10-benzyl-1,4-dioxa-7,10,13-triazacyclopentadecane-6,14-dione |
|---|---|
| PubChem CID | 10088312 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 10-benzyl-1,4-dioxa-7,10,13-triazacyclopentadecane-6,14-dione |
| SMILES | O=C1COCCOCC(=O)NCCN(Cc2ccccc2)CCN1 |
| InChI | InChI=1S/C17H25N3O4/c21-16-13-23-10-11-24-14-17(22)19-7-9-20(8-6-18-16)12-15-4-2-1-3-5-15/h1-5H,6-14H2,(H,18,21)(H,19,22) |
| InChIKey | KGKIVWUCYRUIMD-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |