C24H32N4O4S — CID 11113478
4,13-dibenzyl-1,1-dioxo-1λ6-thia-4,7,10,13-tetrazacyclopentadecane-8,9-dione (PubChem CID 11113478) has the molecular formula C24H32N4O4S and a molecular weight of 472.61 g/mol. Its IUPAC name is 4,13-dibenzyl-1,1-dioxo-1λ6-thia-4,7,10,13-tetrazacyclopentadecane-8,9-dione.
| Compound Name | 4,13-dibenzyl-1,1-dioxo-1λ6-thia-4,7,10,13-tetrazacyclopentadecane-8,9-dione |
|---|---|
| PubChem CID | 11113478 |
| Molecular Formula | C24H32N4O4S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 4,13-dibenzyl-1,1-dioxo-1λ6-thia-4,7,10,13-tetrazacyclopentadecane-8,9-dione |
| SMILES | O=C1NCCN(Cc2ccccc2)CCS(=O)(=O)CCN(Cc2ccccc2)CCNC1=O |
| InChI | InChI=1S/C24H32N4O4S/c29-23-24(30)26-12-14-28(20-22-9-5-2-6-10-22)16-18-33(31,32)17-15-27(13-11-25-23)19-21-7-3-1-4-8-21/h1-10H,11-20H2,(H,25,29)(H,26,30) |
| InChIKey | FFCUUADGWWUKDD-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|