C14H17N3O2S — CID 2738459
4-[(4-pyrazol-1-ylphenyl)methyl]-1,4-thiazinane 1,1-dioxide (PubChem CID 2738459) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is 4-[(4-pyrazol-1-ylphenyl)methyl]-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-[(4-pyrazol-1-ylphenyl)methyl]-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 2738459 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 4-[(4-pyrazol-1-ylphenyl)methyl]-1,4-thiazinane 1,1-dioxide |
| SMILES | O=S1(=O)CCN(Cc2ccc(-n3cccn3)cc2)CC1 |
| InChI | InChI=1S/C14H17N3O2S/c18-20(19)10-8-16(9-11-20)12-13-2-4-14(5-3-13)17-7-1-6-15-17/h1-7H,8-12H2 |
| InChIKey | VWZMTSCPGOSPAW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |