C25H33N5O4 — CID 177459170
3,12-dibenzyl-1-oxa-3,6,9,12,15-pentazacycloheptadecane-2,5,16-trione (PubChem CID 177459170) has the molecular formula C25H33N5O4 and a molecular weight of 467.57 g/mol. Its IUPAC name is 3,12-dibenzyl-1-oxa-3,6,9,12,15-pentazacycloheptadecane-2,5,16-trione.
| Compound Name | 3,12-dibenzyl-1-oxa-3,6,9,12,15-pentazacycloheptadecane-2,5,16-trione |
|---|---|
| PubChem CID | 177459170 |
| Molecular Formula | C25H33N5O4 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | 3,12-dibenzyl-1-oxa-3,6,9,12,15-pentazacycloheptadecane-2,5,16-trione |
| SMILES | O=C1COC(=O)N(Cc2ccccc2)CC(=O)NCCNCCN(Cc2ccccc2)CCN1 |
| InChI | InChI=1S/C25H33N5O4/c31-23-19-30(18-22-9-5-2-6-10-22)25(33)34-20-24(32)28-14-16-29(15-13-26-11-12-27-23)17-21-7-3-1-4-8-21/h1-10,26H,11-20H2,(H,27,31)(H,28,32) |
| InChIKey | WQBMZQGMQIAWAM-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |