C22H22N4O3 — CID 26316556
4-[[3-(1,3-benzodioxol-5-yl)-1-benzylpyrazol-4-yl]methyl]piperazin-2-one (PubChem CID 26316556) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is 4-[[3-(1,3-benzodioxol-5-yl)-1-benzylpyrazol-4-yl]methyl]piperazin-2-one.
| Compound Name | 4-[[3-(1,3-benzodioxol-5-yl)-1-benzylpyrazol-4-yl]methyl]piperazin-2-one |
|---|---|
| PubChem CID | 26316556 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 4-[[3-(1,3-benzodioxol-5-yl)-1-benzylpyrazol-4-yl]methyl]piperazin-2-one |
| SMILES | O=C1CN(Cc2cn(Cc3ccccc3)nc2-c2ccc3c(c2)OCO3)CCN1 |
| InChI | InChI=1S/C22H22N4O3/c27-21-14-25(9-8-23-21)12-18-13-26(11-16-4-2-1-3-5-16)24-22(18)17-6-7-19-20(10-17)29-15-28-19/h1-7,10,13H,8-9,11-12,14-15H2,(H,23,27) |
| InChIKey | PNIRQRWMLXNYOU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |