C18H18N2O3 — CID 110097407
2-[4-[(3-oxopiperazin-1-yl)methyl]phenyl]benzoic acid (PubChem CID 110097407) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is 2-[4-[(3-oxopiperazin-1-yl)methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[(3-oxopiperazin-1-yl)methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 110097407 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 2-[4-[(3-oxopiperazin-1-yl)methyl]phenyl]benzoic acid |
| SMILES | O=C1CN(Cc2ccc(-c3ccccc3C(=O)O)cc2)CCN1 |
| InChI | InChI=1S/C18H18N2O3/c21-17-12-20(10-9-19-17)11-13-5-7-14(8-6-13)15-3-1-2-4-16(15)18(22)23/h1-8H,9-12H2,(H,19,21)(H,22,23) |
| InChIKey | QIIKHMYIUAKWIE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |