C24H25N3O2 — CID 124952709
2-[4-[[(3S)-3-(pyrimidin-2-ylmethyl)piperidin-1-yl]methyl]phenyl]benzoic acid (PubChem CID 124952709) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is 2-[4-[[(3S)-3-(pyrimidin-2-ylmethyl)piperidin-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[(3S)-3-(pyrimidin-2-ylmethyl)piperidin-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 124952709 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 2-[4-[[(3S)-3-(pyrimidin-2-ylmethyl)piperidin-1-yl]methyl]phenyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1-c1ccc(CN2CCC[C@@H](Cc3ncccn3)C2)cc1 |
| InChI | InChI=1S/C24H25N3O2/c28-24(29)22-7-2-1-6-21(22)20-10-8-18(9-11-20)16-27-14-3-5-19(17-27)15-23-25-12-4-13-26-23/h1-2,4,6-13,19H,3,5,14-17H2,(H,28,29)/t19-/m0/s1 |
| InChIKey | DQKZWLBNWBMEOT-IBGZPJMESA-N |
| XLogP | 4.30 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |