C14H15N3O2 — CID 8548455
4-[(5-phenyl-1,2-oxazol-3-yl)methyl]piperazin-2-one (PubChem CID 8548455) has the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. Its IUPAC name is 4-[(5-phenyl-1,2-oxazol-3-yl)methyl]piperazin-2-one.
| Compound Name | 4-[(5-phenyl-1,2-oxazol-3-yl)methyl]piperazin-2-one |
|---|---|
| PubChem CID | 8548455 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 4-[(5-phenyl-1,2-oxazol-3-yl)methyl]piperazin-2-one |
| SMILES | O=C1CN(Cc2cc(-c3ccccc3)on2)CCN1 |
| InChI | InChI=1S/C14H15N3O2/c18-14-10-17(7-6-15-14)9-12-8-13(19-16-12)11-4-2-1-3-5-11/h1-5,8H,6-7,9-10H2,(H,15,18) |
| InChIKey | XMIAHLDCNMPMEX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |