C15H16N4O — CID 79085040
1-[(5-phenyl-1,2-oxazol-3-yl)methyl]piperazine-2-carbonitrile (PubChem CID 79085040) has the molecular formula C15H16N4O and a molecular weight of 268.32 g/mol. Its IUPAC name is 1-[(5-phenyl-1,2-oxazol-3-yl)methyl]piperazine-2-carbonitrile.
| Compound Name | 1-[(5-phenyl-1,2-oxazol-3-yl)methyl]piperazine-2-carbonitrile |
|---|---|
| PubChem CID | 79085040 |
| Molecular Formula | C15H16N4O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 1-[(5-phenyl-1,2-oxazol-3-yl)methyl]piperazine-2-carbonitrile |
| SMILES | N#CC1CNCCN1Cc1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C15H16N4O/c16-9-14-10-17-6-7-19(14)11-13-8-15(20-18-13)12-4-2-1-3-5-12/h1-5,8,14,17H,6-7,10-11H2 |
| InChIKey | YJZIGLQLHUCPDL-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |