C10H15N5 — CID 82868583
1-[(1-methylpyrazol-3-yl)methyl]piperazine-2-carbonitrile (PubChem CID 82868583) has the molecular formula C10H15N5 and a molecular weight of 205.26 g/mol. Its IUPAC name is 1-[(1-methylpyrazol-3-yl)methyl]piperazine-2-carbonitrile.
| Compound Name | 1-[(1-methylpyrazol-3-yl)methyl]piperazine-2-carbonitrile |
|---|---|
| PubChem CID | 82868583 |
| Molecular Formula | C10H15N5 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 1-[(1-methylpyrazol-3-yl)methyl]piperazine-2-carbonitrile |
| SMILES | Cn1ccc(CN2CCNCC2C#N)n1 |
| InChI | InChI=1S/C10H15N5/c1-14-4-2-9(13-14)8-15-5-3-12-7-10(15)6-11/h2,4,10,12H,3,5,7-8H2,1H3 |
| InChIKey | XZBDBYCWSVEKBC-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 56.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |