C11H17N5 — CID 103005283
1-[2-(2-methylpyrazol-3-yl)ethyl]piperazine-2-carbonitrile (PubChem CID 103005283) has the molecular formula C11H17N5 and a molecular weight of 219.29 g/mol. Its IUPAC name is 1-[2-(2-methylpyrazol-3-yl)ethyl]piperazine-2-carbonitrile.
| Compound Name | 1-[2-(2-methylpyrazol-3-yl)ethyl]piperazine-2-carbonitrile |
|---|---|
| PubChem CID | 103005283 |
| Molecular Formula | C11H17N5 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 1-[2-(2-methylpyrazol-3-yl)ethyl]piperazine-2-carbonitrile |
| SMILES | Cn1nccc1CCN1CCNCC1C#N |
| InChI | InChI=1S/C11H17N5/c1-15-10(2-4-14-15)3-6-16-7-5-13-9-11(16)8-12/h2,4,11,13H,3,5-7,9H2,1H3 |
| InChIKey | KAVZFXHQBPIQIP-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 56.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |