C15H19ClN4 — CID 120768956
2-(2-chlorophenyl)-1-[(2-methylpyrazol-3-yl)methyl]piperazine (PubChem CID 120768956) has the molecular formula C15H19ClN4 and a molecular weight of 290.80 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-1-[(2-methylpyrazol-3-yl)methyl]piperazine.
| Compound Name | 2-(2-chlorophenyl)-1-[(2-methylpyrazol-3-yl)methyl]piperazine |
|---|---|
| PubChem CID | 120768956 |
| Molecular Formula | C15H19ClN4 |
| Molecular Weight | 290.80 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 2-(2-chlorophenyl)-1-[(2-methylpyrazol-3-yl)methyl]piperazine |
| SMILES | Cn1nccc1CN1CCNCC1c1ccccc1Cl |
| InChI | InChI=1S/C15H19ClN4/c1-19-12(6-7-18-19)11-20-9-8-17-10-15(20)13-4-2-3-5-14(13)16/h2-7,15,17H,8-11H2,1H3 |
| InChIKey | FNIUJLRWZDFXAH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.80 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |