C17H24Cl2N4 — CID 120757443
2-(2-chlorophenyl)-1-[(1-propan-2-ylpyrazol-3-yl)methyl]piperazine;hydrochloride (PubChem CID 120757443) has the molecular formula C17H24Cl2N4 and a molecular weight of 355.31 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-1-[(1-propan-2-ylpyrazol-3-yl)methyl]piperazine;hydrochloride.
| Compound Name | 2-(2-chlorophenyl)-1-[(1-propan-2-ylpyrazol-3-yl)methyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 120757443 |
| Molecular Formula | C17H24Cl2N4 |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 2-(2-chlorophenyl)-1-[(1-propan-2-ylpyrazol-3-yl)methyl]piperazine;hydrochloride |
| SMILES | CC(C)n1ccc(CN2CCNCC2c2ccccc2Cl)n1.Cl |
| InChI | InChI=1S/C17H23ClN4.ClH/c1-13(2)22-9-7-14(20-22)12-21-10-8-19-11-17(21)15-5-3-4-6-16(15)18;/h3-7,9,13,17,19H,8,10-12H2,1-2H3;1H |
| InChIKey | MOMZNQYJVCRKOD-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |