C16H20ClN3S — CID 120768960
4-[[2-(2-chlorophenyl)piperazin-1-yl]methyl]-2-ethyl-1,3-thiazole (PubChem CID 120768960) has the molecular formula C16H20ClN3S and a molecular weight of 321.88 g/mol. Its IUPAC name is 4-[[2-(2-chlorophenyl)piperazin-1-yl]methyl]-2-ethyl-1,3-thiazole.
| Compound Name | 4-[[2-(2-chlorophenyl)piperazin-1-yl]methyl]-2-ethyl-1,3-thiazole |
|---|---|
| PubChem CID | 120768960 |
| Molecular Formula | C16H20ClN3S |
| Molecular Weight | 321.88 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 4-[[2-(2-chlorophenyl)piperazin-1-yl]methyl]-2-ethyl-1,3-thiazole |
| SMILES | CCc1nc(CN2CCNCC2c2ccccc2Cl)cs1 |
| InChI | InChI=1S/C16H20ClN3S/c1-2-16-19-12(11-21-16)10-20-8-7-18-9-15(20)13-5-3-4-6-14(13)17/h3-6,11,15,18H,2,7-10H2,1H3 |
| InChIKey | XVUHNOLCBXUZSC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.88 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |