C14H19N3O2 — CID 79085566
1-[2-(2-methoxyphenoxy)ethyl]piperazine-2-carbonitrile (PubChem CID 79085566) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 1-[2-(2-methoxyphenoxy)ethyl]piperazine-2-carbonitrile.
| Compound Name | 1-[2-(2-methoxyphenoxy)ethyl]piperazine-2-carbonitrile |
|---|---|
| PubChem CID | 79085566 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 1-[2-(2-methoxyphenoxy)ethyl]piperazine-2-carbonitrile |
| SMILES | COc1ccccc1OCCN1CCNCC1C#N |
| InChI | InChI=1S/C14H19N3O2/c1-18-13-4-2-3-5-14(13)19-9-8-17-7-6-16-11-12(17)10-15/h2-5,12,16H,6-9,11H2,1H3 |
| InChIKey | TWGMOKWJBMILHN-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 57.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |