C15H19N3O2 — CID 79086081
1-[(5-acetyl-2-methoxyphenyl)methyl]piperazine-2-carbonitrile (PubChem CID 79086081) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 1-[(5-acetyl-2-methoxyphenyl)methyl]piperazine-2-carbonitrile.
| Compound Name | 1-[(5-acetyl-2-methoxyphenyl)methyl]piperazine-2-carbonitrile |
|---|---|
| PubChem CID | 79086081 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 1-[(5-acetyl-2-methoxyphenyl)methyl]piperazine-2-carbonitrile |
| SMILES | COc1ccc(C(C)=O)cc1CN1CCNCC1C#N |
| InChI | InChI=1S/C15H19N3O2/c1-11(19)12-3-4-15(20-2)13(7-12)10-18-6-5-17-9-14(18)8-16/h3-4,7,14,17H,5-6,9-10H2,1-2H3 |
| InChIKey | RPRMMHZPTBIYTO-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |