C15H16ClN3OS — CID 43320465
4-[[3-[4-(chloromethyl)-1,3-thiazol-2-yl]phenyl]methyl]piperazin-2-one (PubChem CID 43320465) has the molecular formula C15H16ClN3OS and a molecular weight of 321.83 g/mol. Its IUPAC name is 4-[[3-[4-(chloromethyl)-1,3-thiazol-2-yl]phenyl]methyl]piperazin-2-one.
| Compound Name | 4-[[3-[4-(chloromethyl)-1,3-thiazol-2-yl]phenyl]methyl]piperazin-2-one |
|---|---|
| PubChem CID | 43320465 |
| Molecular Formula | C15H16ClN3OS |
| Molecular Weight | 321.83 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 4-[[3-[4-(chloromethyl)-1,3-thiazol-2-yl]phenyl]methyl]piperazin-2-one |
| SMILES | O=C1CN(Cc2cccc(-c3nc(CCl)cs3)c2)CCN1 |
| InChI | InChI=1S/C15H16ClN3OS/c16-7-13-10-21-15(18-13)12-3-1-2-11(6-12)8-19-5-4-17-14(20)9-19/h1-3,6,10H,4-5,7-9H2,(H,17,20) |
| InChIKey | DVNYMDAUNUDRTO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.83 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|