About 5-[(3-oxopiperazin-1-yl)methyl]-1,2-oxazole-3-carboxylic acid
5-[(3-oxopiperazin-1-yl)methyl]-1,2-oxazole-3-carboxylic acid (PubChem CID 61397934) has the molecular formula C9H11N3O4
and a molecular weight of 225.20 g/mol. Its IUPAC name is 5-[(3-oxopiperazin-1-yl)methyl]-1,2-oxazole-3-carboxylic acid.
Analyze 5-[(3-oxopiperazin-1-yl)methyl]-1,2-oxazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3-oxopiperazin-1-yl)methyl]-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 5-[(3-oxopiperazin-1-yl)methyl]-1,2-oxazole-3-carboxylic acid (CID 61397934) is 5-[(3-oxopiperazin-1-yl)methyl]-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 5-[(3-oxopiperazin-1-yl)methyl]-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 5-[(3-oxopiperazin-1-yl)methyl]-1,2-oxazole-3-carboxylic acid is O=C1CN(Cc2cc(C(=O)O)no2)CCN1.
What is the InChIKey of 5-[(3-oxopiperazin-1-yl)methyl]-1,2-oxazole-3-carboxylic acid?
The InChIKey is SZNVVAXAKSSPOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O4/c13-8-5-12(2-1-10-8)4-6-3-7(9(14)15)11-16-6/h3H,1-2,4-5H2,(H,10,13)(H,14,15).
What are the key properties of 5-[(3-oxopiperazin-1-yl)methyl]-1,2-oxazole-3-carboxylic acid?
5-[(3-oxopiperazin-1-yl)methyl]-1,2-oxazole-3-carboxylic acid has a molecular weight of 225.20 g/mol, XLogP of -0.70, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3-oxopiperazin-1-yl)methyl]-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 61397934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).