C10H14N4O3 — CID 63568674
5-[(3-oxopiperazin-1-yl)methyl]furan-3-carbohydrazide (PubChem CID 63568674) has the molecular formula C10H14N4O3 and a molecular weight of 238.25 g/mol. Its IUPAC name is 5-[(3-oxopiperazin-1-yl)methyl]furan-3-carbohydrazide.
| Compound Name | 5-[(3-oxopiperazin-1-yl)methyl]furan-3-carbohydrazide |
|---|---|
| PubChem CID | 63568674 |
| Molecular Formula | C10H14N4O3 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 5-[(3-oxopiperazin-1-yl)methyl]furan-3-carbohydrazide |
| SMILES | NNC(=O)c1coc(CN2CCNC(=O)C2)c1 |
| InChI | InChI=1S/C10H14N4O3/c11-13-10(16)7-3-8(17-6-7)4-14-2-1-12-9(15)5-14/h3,6H,1-2,4-5,11H2,(H,12,15)(H,13,16) |
| InChIKey | UZMCUYCKGGNJFS-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 100.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|