C12H17F3N4O2 — CID 63584824
5-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]furan-3-carbohydrazide (PubChem CID 63584824) has the molecular formula C12H17F3N4O2 and a molecular weight of 306.29 g/mol. Its IUPAC name is 5-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]furan-3-carbohydrazide.
| Compound Name | 5-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]furan-3-carbohydrazide |
|---|---|
| PubChem CID | 63584824 |
| Molecular Formula | C12H17F3N4O2 |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 5-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]furan-3-carbohydrazide |
| SMILES | NNC(=O)c1coc(CN2CCN(CC(F)(F)F)CC2)c1 |
| InChI | InChI=1S/C12H17F3N4O2/c13-12(14,15)8-19-3-1-18(2-4-19)6-10-5-9(7-21-10)11(20)17-16/h5,7H,1-4,6,8,16H2,(H,17,20) |
| InChIKey | KHJCOMRSQXFUMF-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|