C15H19N3O — CID 104977337
3-[[(3S)-3-methylpiperazin-1-yl]methyl]-5-phenyl-1,2-oxazole (PubChem CID 104977337) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is 3-[[(3S)-3-methylpiperazin-1-yl]methyl]-5-phenyl-1,2-oxazole.
| Compound Name | 3-[[(3S)-3-methylpiperazin-1-yl]methyl]-5-phenyl-1,2-oxazole |
|---|---|
| PubChem CID | 104977337 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 3-[[(3S)-3-methylpiperazin-1-yl]methyl]-5-phenyl-1,2-oxazole |
| SMILES | C[C@H]1CN(Cc2cc(-c3ccccc3)on2)CCN1 |
| InChI | InChI=1S/C15H19N3O/c1-12-10-18(8-7-16-12)11-14-9-15(19-17-14)13-5-3-2-4-6-13/h2-6,9,12,16H,7-8,10-11H2,1H3/t12-/m0/s1 |
| InChIKey | GQDGRIGDTFIWGY-LBPRGKRZSA-N |
| XLogP | 2.14 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |