C13H21N3 — CID 63771215
2-(1,4-diazepan-1-yl)-1-phenylethanamine (PubChem CID 63771215) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-1-phenylethanamine.
| Compound Name | 2-(1,4-diazepan-1-yl)-1-phenylethanamine |
|---|---|
| PubChem CID | 63771215 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-1-phenylethanamine |
| SMILES | NC(CN1CCCNCC1)c1ccccc1 |
| InChI | InChI=1S/C13H21N3/c14-13(12-5-2-1-3-6-12)11-16-9-4-7-15-8-10-16/h1-3,5-6,13,15H,4,7-11,14H2 |
| InChIKey | OEUAUPLXFZUYIT-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |