C15H23N3O2 — CID 107862973
2-(1,4-diazepan-1-yl)-N-[(1S)-2-hydroxy-1-phenylethyl]acetamide (PubChem CID 107862973) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-N-[(1S)-2-hydroxy-1-phenylethyl]acetamide.
| Compound Name | 2-(1,4-diazepan-1-yl)-N-[(1S)-2-hydroxy-1-phenylethyl]acetamide |
|---|---|
| PubChem CID | 107862973 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-N-[(1S)-2-hydroxy-1-phenylethyl]acetamide |
| SMILES | O=C(CN1CCCNCC1)N[C@H](CO)c1ccccc1 |
| InChI | InChI=1S/C15H23N3O2/c19-12-14(13-5-2-1-3-6-13)17-15(20)11-18-9-4-7-16-8-10-18/h1-3,5-6,14,16,19H,4,7-12H2,(H,17,20)/t14-/m1/s1 |
| InChIKey | WAUDSAWKZVNFJR-CQSZACIVSA-N |
| XLogP | 0.13 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |