C14H22N4O — CID 81404554
2-(1,4-diazepan-1-yl)-N-[(1R)-1-pyridin-3-ylethyl]acetamide (PubChem CID 81404554) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-N-[(1R)-1-pyridin-3-ylethyl]acetamide.
| Compound Name | 2-(1,4-diazepan-1-yl)-N-[(1R)-1-pyridin-3-ylethyl]acetamide |
|---|---|
| PubChem CID | 81404554 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-N-[(1R)-1-pyridin-3-ylethyl]acetamide |
| SMILES | C[C@@H](NC(=O)CN1CCCNCC1)c1cccnc1 |
| InChI | InChI=1S/C14H22N4O/c1-12(13-4-2-5-16-10-13)17-14(19)11-18-8-3-6-15-7-9-18/h2,4-5,10,12,15H,3,6-9,11H2,1H3,(H,17,19)/t12-/m1/s1 |
| InChIKey | SQJAWYCOACVGCV-GFCCVEGCSA-N |
| XLogP | 0.55 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |