C14H23N3OS — CID 62832743
2-(1,4-diazepan-1-yl)-N-(1-thiophen-2-ylpropyl)acetamide (PubChem CID 62832743) has the molecular formula C14H23N3OS and a molecular weight of 281.42 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-N-(1-thiophen-2-ylpropyl)acetamide.
| Compound Name | 2-(1,4-diazepan-1-yl)-N-(1-thiophen-2-ylpropyl)acetamide |
|---|---|
| PubChem CID | 62832743 |
| Molecular Formula | C14H23N3OS |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-N-(1-thiophen-2-ylpropyl)acetamide |
| SMILES | CCC(NC(=O)CN1CCCNCC1)c1cccs1 |
| InChI | InChI=1S/C14H23N3OS/c1-2-12(13-5-3-10-19-13)16-14(18)11-17-8-4-6-15-7-9-17/h3,5,10,12,15H,2,4,6-9,11H2,1H3,(H,16,18) |
| InChIKey | ZKZGKNMBZMGCSR-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |