C18H30N4O2S — CID 134045399
N-butan-2-yl-2-[4-[2-oxo-2-(1-thiophen-2-ylethylamino)ethyl]piperazin-1-yl]acetamide (PubChem CID 134045399) has the molecular formula C18H30N4O2S and a molecular weight of 366.53 g/mol. Its IUPAC name is N-butan-2-yl-2-[4-[2-oxo-2-(1-thiophen-2-ylethylamino)ethyl]piperazin-1-yl]acetamide.
| Compound Name | N-butan-2-yl-2-[4-[2-oxo-2-(1-thiophen-2-ylethylamino)ethyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 134045399 |
| Molecular Formula | C18H30N4O2S |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | N-butan-2-yl-2-[4-[2-oxo-2-(1-thiophen-2-ylethylamino)ethyl]piperazin-1-yl]acetamide |
| SMILES | CCC(C)NC(=O)CN1CCN(CC(=O)NC(C)c2cccs2)CC1 |
| InChI | InChI=1S/C18H30N4O2S/c1-4-14(2)19-17(23)12-21-7-9-22(10-8-21)13-18(24)20-15(3)16-6-5-11-25-16/h5-6,11,14-15H,4,7-10,12-13H2,1-3H3,(H,19,23)(H,20,24) |
| InChIKey | SMKKRIFBVLSSQE-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |