C16H25N3O2S — CID 17487495
2-[4-(2-methylpropanoyl)piperazin-1-yl]-N-(1-thiophen-2-ylethyl)acetamide (PubChem CID 17487495) has the molecular formula C16H25N3O2S and a molecular weight of 323.46 g/mol. Its IUPAC name is 2-[4-(2-methylpropanoyl)piperazin-1-yl]-N-(1-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-[4-(2-methylpropanoyl)piperazin-1-yl]-N-(1-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 17487495 |
| Molecular Formula | C16H25N3O2S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 2-[4-(2-methylpropanoyl)piperazin-1-yl]-N-(1-thiophen-2-ylethyl)acetamide |
| SMILES | CC(C)C(=O)N1CCN(CC(=O)NC(C)c2cccs2)CC1 |
| InChI | InChI=1S/C16H25N3O2S/c1-12(2)16(21)19-8-6-18(7-9-19)11-15(20)17-13(3)14-5-4-10-22-14/h4-5,10,12-13H,6-9,11H2,1-3H3,(H,17,20) |
| InChIKey | OUBIQOILMDTZAG-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |