C13H22N4O — CID 79100773
2-(1,4-diazepan-1-yl)-N-(2,5-dimethylpyrrol-1-yl)acetamide (PubChem CID 79100773) has the molecular formula C13H22N4O and a molecular weight of 250.35 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-N-(2,5-dimethylpyrrol-1-yl)acetamide.
| Compound Name | 2-(1,4-diazepan-1-yl)-N-(2,5-dimethylpyrrol-1-yl)acetamide |
|---|---|
| PubChem CID | 79100773 |
| Molecular Formula | C13H22N4O |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-N-(2,5-dimethylpyrrol-1-yl)acetamide |
| SMILES | Cc1ccc(C)n1NC(=O)CN1CCCNCC1 |
| InChI | InChI=1S/C13H22N4O/c1-11-4-5-12(2)17(11)15-13(18)10-16-8-3-6-14-7-9-16/h4-5,14H,3,6-10H2,1-2H3,(H,15,18) |
| InChIKey | CBDPIIOMHUICGO-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 49.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |