About 1-piperazin-1-ylsulfonyl-1,4-diazepan-5-one
1-piperazin-1-ylsulfonyl-1,4-diazepan-5-one (PubChem CID 55135469) has the molecular formula C9H18N4O3S
and a molecular weight of 262.33 g/mol. Its IUPAC name is 1-piperazin-1-ylsulfonyl-1,4-diazepan-5-one.
Molecular Properties
| Compound Name | 1-piperazin-1-ylsulfonyl-1,4-diazepan-5-one |
| PubChem CID | 55135469 |
| Molecular Formula | C9H18N4O3S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 1-piperazin-1-ylsulfonyl-1,4-diazepan-5-one |
| SMILES | O=C1CCN(S(=O)(=O)N2CCNCC2)CCN1 |
| InChI | InChI=1S/C9H18N4O3S/c14-9-1-5-12(8-4-11-9)17(15,16)13-6-2-10-3-7-13/h10H,1-8H2,(H,11,14) |
| InChIKey | MGDHTPOVOGXOSK-UHFFFAOYSA-N |
| XLogP | -2.04 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-piperazin-1-ylsulfonyl-1,4-diazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-piperazin-1-ylsulfonyl-1,4-diazepan-5-one?
The IUPAC name of 1-piperazin-1-ylsulfonyl-1,4-diazepan-5-one (CID 55135469) is 1-piperazin-1-ylsulfonyl-1,4-diazepan-5-one.
What is the SMILES notation for 1-piperazin-1-ylsulfonyl-1,4-diazepan-5-one?
The canonical SMILES for 1-piperazin-1-ylsulfonyl-1,4-diazepan-5-one is O=C1CCN(S(=O)(=O)N2CCNCC2)CCN1.
What is the InChIKey of 1-piperazin-1-ylsulfonyl-1,4-diazepan-5-one?
The InChIKey is MGDHTPOVOGXOSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N4O3S/c14-9-1-5-12(8-4-11-9)17(15,16)13-6-2-10-3-7-13/h10H,1-8H2,(H,11,14).
What are the key properties of 1-piperazin-1-ylsulfonyl-1,4-diazepan-5-one?
1-piperazin-1-ylsulfonyl-1,4-diazepan-5-one has a molecular weight of 262.33 g/mol, XLogP of -2.04, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-piperazin-1-ylsulfonyl-1,4-diazepan-5-one is sourced from PubChem (CID 55135469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).