About molecular hydrogen;1-piperazin-1-ylsulfonylazepane;hydrochloride
molecular hydrogen;1-piperazin-1-ylsulfonylazepane;hydrochloride (PubChem CID 43842038) has the molecular formula C10H24ClN3O2S
and a molecular weight of 285.84 g/mol. Its IUPAC name is molecular hydrogen;1-piperazin-1-ylsulfonylazepane;hydrochloride.
Molecular Properties
| Compound Name | molecular hydrogen;1-piperazin-1-ylsulfonylazepane;hydrochloride |
| PubChem CID | 43842038 |
| Molecular Formula | C10H24ClN3O2S |
| Molecular Weight | 285.84 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | molecular hydrogen;1-piperazin-1-ylsulfonylazepane;hydrochloride |
| SMILES | Cl.O=S(=O)(N1CCCCCC1)N1CCNCC1.[H][H] |
| InChI | InChI=1S/C10H21N3O2S.ClH.H2/c14-16(15,13-9-5-11-6-10-13)12-7-3-1-2-4-8-12;;/h11H,1-10H2;2*1H |
| InChIKey | UZHXBTOXOPYCGN-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.84 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze molecular hydrogen;1-piperazin-1-ylsulfonylazepane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular hydrogen;1-piperazin-1-ylsulfonylazepane;hydrochloride?
The IUPAC name of molecular hydrogen;1-piperazin-1-ylsulfonylazepane;hydrochloride (CID 43842038) is molecular hydrogen;1-piperazin-1-ylsulfonylazepane;hydrochloride.
What is the SMILES notation for molecular hydrogen;1-piperazin-1-ylsulfonylazepane;hydrochloride?
The canonical SMILES for molecular hydrogen;1-piperazin-1-ylsulfonylazepane;hydrochloride is Cl.O=S(=O)(N1CCCCCC1)N1CCNCC1.[H][H].
What is the InChIKey of molecular hydrogen;1-piperazin-1-ylsulfonylazepane;hydrochloride?
The InChIKey is UZHXBTOXOPYCGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N3O2S.ClH.H2/c14-16(15,13-9-5-11-6-10-13)12-7-3-1-2-4-8-12;;/h11H,1-10H2;2*1H.
What are the key properties of molecular hydrogen;1-piperazin-1-ylsulfonylazepane;hydrochloride?
molecular hydrogen;1-piperazin-1-ylsulfonylazepane;hydrochloride has a molecular weight of 285.84 g/mol, XLogP of 0.68, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;1-piperazin-1-ylsulfonylazepane;hydrochloride is sourced from PubChem (CID 43842038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).