C9H20ClN3O3S — CID 22707010
4-(1,4-diazepan-1-ylsulfonyl)morpholine;hydrochloride (PubChem CID 22707010) has the molecular formula C9H20ClN3O3S and a molecular weight of 285.80 g/mol. Its IUPAC name is 4-(1,4-diazepan-1-ylsulfonyl)morpholine;hydrochloride.
| Compound Name | 4-(1,4-diazepan-1-ylsulfonyl)morpholine;hydrochloride |
|---|---|
| PubChem CID | 22707010 |
| Molecular Formula | C9H20ClN3O3S |
| Molecular Weight | 285.80 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 4-(1,4-diazepan-1-ylsulfonyl)morpholine;hydrochloride |
| SMILES | Cl.O=S(=O)(N1CCCNCC1)N1CCOCC1 |
| InChI | InChI=1S/C9H19N3O3S.ClH/c13-16(14,12-6-8-15-9-7-12)11-4-1-2-10-3-5-11;/h10H,1-9H2;1H |
| InChIKey | IQUBTKLCZMSAPX-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.80 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |