C10H21ClN2O3S — CID 119963176
1-(oxolan-3-ylmethylsulfonyl)-1,4-diazepane;hydrochloride (PubChem CID 119963176) has the molecular formula C10H21ClN2O3S and a molecular weight of 284.81 g/mol. Its IUPAC name is 1-(oxolan-3-ylmethylsulfonyl)-1,4-diazepane;hydrochloride.
| Compound Name | 1-(oxolan-3-ylmethylsulfonyl)-1,4-diazepane;hydrochloride |
|---|---|
| PubChem CID | 119963176 |
| Molecular Formula | C10H21ClN2O3S |
| Molecular Weight | 284.81 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 1-(oxolan-3-ylmethylsulfonyl)-1,4-diazepane;hydrochloride |
| SMILES | Cl.O=S(=O)(CC1CCOC1)N1CCCNCC1 |
| InChI | InChI=1S/C10H20N2O3S.ClH/c13-16(14,9-10-2-7-15-8-10)12-5-1-3-11-4-6-12;/h10-11H,1-9H2;1H |
| InChIKey | KBJHMQCJQGYQOG-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.81 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |