C11H25ClN2O2S — CID 119963310
1-(2-ethylbutylsulfonyl)-1,4-diazepane;hydrochloride (PubChem CID 119963310) has the molecular formula C11H25ClN2O2S and a molecular weight of 284.85 g/mol. Its IUPAC name is 1-(2-ethylbutylsulfonyl)-1,4-diazepane;hydrochloride.
| Compound Name | 1-(2-ethylbutylsulfonyl)-1,4-diazepane;hydrochloride |
|---|---|
| PubChem CID | 119963310 |
| Molecular Formula | C11H25ClN2O2S |
| Molecular Weight | 284.85 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 1-(2-ethylbutylsulfonyl)-1,4-diazepane;hydrochloride |
| SMILES | CCC(CC)CS(=O)(=O)N1CCCNCC1.Cl |
| InChI | InChI=1S/C11H24N2O2S.ClH/c1-3-11(4-2)10-16(14,15)13-8-5-6-12-7-9-13;/h11-12H,3-10H2,1-2H3;1H |
| InChIKey | PCPGZSHUWUGJDV-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.85 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |