C9H20N2O2S — CID 63687283
1-tert-butylsulfonyl-1,4-diazepane (PubChem CID 63687283) has the molecular formula C9H20N2O2S and a molecular weight of 220.34 g/mol. Its IUPAC name is 1-tert-butylsulfonyl-1,4-diazepane.
| Compound Name | 1-tert-butylsulfonyl-1,4-diazepane |
|---|---|
| PubChem CID | 63687283 |
| Molecular Formula | C9H20N2O2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 1-tert-butylsulfonyl-1,4-diazepane |
| SMILES | CC(C)(C)S(=O)(=O)N1CCCNCC1 |
| InChI | InChI=1S/C9H20N2O2S/c1-9(2,3)14(12,13)11-7-4-5-10-6-8-11/h10H,4-8H2,1-3H3 |
| InChIKey | KFOMXRFOAKIBFO-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |