C15H33F3N6O2S — CID 175452379
1-(trifluoromethylsulfonyl)-1,4,7,10,14,17-hexazacycloicosane (PubChem CID 175452379) has the molecular formula C15H33F3N6O2S and a molecular weight of 418.53 g/mol. Its IUPAC name is 1-(trifluoromethylsulfonyl)-1,4,7,10,14,17-hexazacycloicosane.
| Compound Name | 1-(trifluoromethylsulfonyl)-1,4,7,10,14,17-hexazacycloicosane |
|---|---|
| PubChem CID | 175452379 |
| Molecular Formula | C15H33F3N6O2S |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | 1-(trifluoromethylsulfonyl)-1,4,7,10,14,17-hexazacycloicosane |
| SMILES | O=S(=O)(N1CCCNCCNCCCNCCNCCNCC1)C(F)(F)F |
| InChI | InChI=1S/C15H33F3N6O2S/c16-15(17,18)27(25,26)24-13-2-5-21-7-6-19-3-1-4-20-8-9-22-10-11-23-12-14-24/h19-23H,1-14H2 |
| InChIKey | WTTDEFPTSNZYKF-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 97.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |