C8H9F9N2O7S3 — CID 134286034
trifluoromethylsulfonyl 1,1,2,2,3,3-hexafluoro-3-piperazin-1-ylsulfonylpropane-1-sulfonate (PubChem CID 134286034) has the molecular formula C8H9F9N2O7S3 and a molecular weight of 512.35 g/mol. Its IUPAC name is trifluoromethylsulfonyl 1,1,2,2,3,3-hexafluoro-3-piperazin-1-ylsulfonylpropane-1-sulfonate.
| Compound Name | trifluoromethylsulfonyl 1,1,2,2,3,3-hexafluoro-3-piperazin-1-ylsulfonylpropane-1-sulfonate |
|---|---|
| PubChem CID | 134286034 |
| Molecular Formula | C8H9F9N2O7S3 |
| Molecular Weight | 512.35 g/mol |
| Exact Mass | 511.94 |
| IUPAC Name | trifluoromethylsulfonyl 1,1,2,2,3,3-hexafluoro-3-piperazin-1-ylsulfonylpropane-1-sulfonate |
| SMILES | O=S(=O)(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)N1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C8H9F9N2O7S3/c9-5(10,6(11,12)27(20,21)19-3-1-18-2-4-19)7(13,14)28(22,23)26-29(24,25)8(15,16)17/h18H,1-4H2 |
| InChIKey | LUYKTSNIWRWYNW-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.35 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|