C9H11F6NO5S — CID 59817175
2,2,3,3,4,4-hexafluoro-4-piperidin-1-ylsulfonylbutaneperoxoic acid (PubChem CID 59817175) has the molecular formula C9H11F6NO5S and a molecular weight of 359.24 g/mol. Its IUPAC name is 2,2,3,3,4,4-hexafluoro-4-piperidin-1-ylsulfonylbutaneperoxoic acid.
| Compound Name | 2,2,3,3,4,4-hexafluoro-4-piperidin-1-ylsulfonylbutaneperoxoic acid |
|---|---|
| PubChem CID | 59817175 |
| Molecular Formula | C9H11F6NO5S |
| Molecular Weight | 359.24 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | 2,2,3,3,4,4-hexafluoro-4-piperidin-1-ylsulfonylbutaneperoxoic acid |
| SMILES | O=C(OO)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C9H11F6NO5S/c10-7(11,6(17)21-18)8(12,13)9(14,15)22(19,20)16-4-2-1-3-5-16/h18H,1-5H2 |
| InChIKey | UUXCOIULTHVZEQ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.24 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|