C13H20F6N2O5S2 — CID 89349426
1-[1,1,2,2,3,3-hexafluoro-3-(trioxidanylsulfanyl)propyl]sulfonyl-4-piperidin-1-ylpiperidine (PubChem CID 89349426) has the molecular formula C13H20F6N2O5S2 and a molecular weight of 462.43 g/mol. Its IUPAC name is 1-[1,1,2,2,3,3-hexafluoro-3-(trioxidanylsulfanyl)propyl]sulfonyl-4-piperidin-1-ylpiperidine.
| Compound Name | 1-[1,1,2,2,3,3-hexafluoro-3-(trioxidanylsulfanyl)propyl]sulfonyl-4-piperidin-1-ylpiperidine |
|---|---|
| PubChem CID | 89349426 |
| Molecular Formula | C13H20F6N2O5S2 |
| Molecular Weight | 462.43 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | 1-[1,1,2,2,3,3-hexafluoro-3-(trioxidanylsulfanyl)propyl]sulfonyl-4-piperidin-1-ylpiperidine |
| SMILES | O=S(=O)(N1CCC(N2CCCCC2)CC1)C(F)(F)C(F)(F)C(F)(F)SOOO |
| InChI | InChI=1S/C13H20F6N2O5S2/c14-11(15,12(16,17)27-26-25-22)13(18,19)28(23,24)21-8-4-10(5-9-21)20-6-2-1-3-7-20/h10,22H,1-9H2 |
| InChIKey | YUWAVDIZARGTTO-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|