C14H12F16O8S2 — CID 58616489
1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[4-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trioxidanylsulfanyl)ethoxy]ethyl]cyclohexyl]ethoxy]ethanesulfonic acid (PubChem CID 58616489) has the molecular formula C14H12F16O8S2 and a molecular weight of 676.34 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[4-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trioxidanylsulfanyl)ethoxy]ethyl]cyclohexyl]ethoxy]ethanesulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[4-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trioxidanylsulfanyl)ethoxy]ethyl]cyclohexyl]ethoxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 58616489 |
| Molecular Formula | C14H12F16O8S2 |
| Molecular Weight | 676.34 g/mol |
| Exact Mass | 675.97 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[4-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trioxidanylsulfanyl)ethoxy]ethyl]cyclohexyl]ethoxy]ethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)C1CCC(C(F)(F)C(F)(F)OC(F)(F)C(F)(F)SOOO)CC1 |
| InChI | InChI=1S/C14H12F16O8S2/c15-7(16,9(19,20)35-11(23,24)13(27,28)39-38-37-31)5-1-3-6(4-2-5)8(17,18)10(21,22)36-12(25,26)14(29,30)40(32,33)34/h5-6,31H,1-4H2,(H,32,33,34) |
| InChIKey | QAHIRYAFAMAGCQ-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.34 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|