C5H3F8O7S2- — CID 20758401
methyl 1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-oxidoperoxysulfanylethoxy)ethanesulfonate (PubChem CID 20758401) has the molecular formula C5H3F8O7S2- and a molecular weight of 391.19 g/mol. Its IUPAC name is methyl 1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-oxidoperoxysulfanylethoxy)ethanesulfonate.
| Compound Name | methyl 1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-oxidoperoxysulfanylethoxy)ethanesulfonate |
|---|---|
| PubChem CID | 20758401 |
| Molecular Formula | C5H3F8O7S2- |
| Molecular Weight | 391.19 g/mol |
| Exact Mass | 390.92 |
| IUPAC Name | methyl 1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-oxidoperoxysulfanylethoxy)ethanesulfonate |
| SMILES | COS(=O)(=O)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)SOO[O-] |
| InChI | InChI=1S/C5H4F8O7S2/c1-17-22(15,16)5(12,13)3(8,9)18-2(6,7)4(10,11)21-20-19-14/h14H,1H3/p-1 |
| InChIKey | HJJFXAOKIIKXQL-UHFFFAOYSA-M |
| XLogP | 1.22 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.19 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|