About copper;methyl trifluoromethanesulfonate
copper;methyl trifluoromethanesulfonate (PubChem CID 174775711) has the molecular formula C2H3CuF3O3S
and a molecular weight of 227.65 g/mol. Its IUPAC name is copper;methyl trifluoromethanesulfonate.
Molecular Properties
| Compound Name | copper;methyl trifluoromethanesulfonate |
| PubChem CID | 174775711 |
| Molecular Formula | C2H3CuF3O3S |
| Molecular Weight | 227.65 g/mol |
| Exact Mass | 226.91 |
| IUPAC Name | copper;methyl trifluoromethanesulfonate |
| SMILES | COS(=O)(=O)C(F)(F)F.[Cu] |
| InChI | InChI=1S/C2H3F3O3S.Cu/c1-8-9(6,7)2(3,4)5;/h1H3; |
| InChIKey | YQPRSUCYKMLWBS-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.65 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze copper;methyl trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;methyl trifluoromethanesulfonate?
The IUPAC name of copper;methyl trifluoromethanesulfonate (CID 174775711) is copper;methyl trifluoromethanesulfonate.
What is the SMILES notation for copper;methyl trifluoromethanesulfonate?
The canonical SMILES for copper;methyl trifluoromethanesulfonate is COS(=O)(=O)C(F)(F)F.[Cu].
What is the InChIKey of copper;methyl trifluoromethanesulfonate?
The InChIKey is YQPRSUCYKMLWBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3F3O3S.Cu/c1-8-9(6,7)2(3,4)5;/h1H3;.
What are the key properties of copper;methyl trifluoromethanesulfonate?
copper;methyl trifluoromethanesulfonate has a molecular weight of 227.65 g/mol, XLogP of 0.48, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for copper;methyl trifluoromethanesulfonate is sourced from PubChem (CID 174775711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).