About amino(trioctyl)phosphanium;methyl trifluoromethanesulfonate
amino(trioctyl)phosphanium;methyl trifluoromethanesulfonate (PubChem CID 174815242) has the molecular formula C26H56F3NO3PS+
and a molecular weight of 550.77 g/mol. Its IUPAC name is amino(trioctyl)phosphanium;methyl trifluoromethanesulfonate.
Molecular Properties
| Compound Name | amino(trioctyl)phosphanium;methyl trifluoromethanesulfonate |
| PubChem CID | 174815242 |
| Molecular Formula | C26H56F3NO3PS+ |
| Molecular Weight | 550.77 g/mol |
| Exact Mass | 550.37 |
| IUPAC Name | amino(trioctyl)phosphanium;methyl trifluoromethanesulfonate |
| SMILES | CCCCCCCC[P+](N)(CCCCCCCC)CCCCCCCC.COS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C24H53NP.C2H3F3O3S/c1-4-7-10-13-16-19-22-26(25,23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;1-8-9(6,7)2(3,4)5/h4-25H2,1-3H3;1H3/q+1; |
| InChIKey | CLECMUIYWSFFES-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 550.77 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze amino(trioctyl)phosphanium;methyl trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino(trioctyl)phosphanium;methyl trifluoromethanesulfonate?
The IUPAC name of amino(trioctyl)phosphanium;methyl trifluoromethanesulfonate (CID 174815242) is amino(trioctyl)phosphanium;methyl trifluoromethanesulfonate.
What is the SMILES notation for amino(trioctyl)phosphanium;methyl trifluoromethanesulfonate?
The canonical SMILES for amino(trioctyl)phosphanium;methyl trifluoromethanesulfonate is CCCCCCCC[P+](N)(CCCCCCCC)CCCCCCCC.COS(=O)(=O)C(F)(F)F.
What is the InChIKey of amino(trioctyl)phosphanium;methyl trifluoromethanesulfonate?
The InChIKey is CLECMUIYWSFFES-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H53NP.C2H3F3O3S/c1-4-7-10-13-16-19-22-26(25,23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;1-8-9(6,7)2(3,4)5/h4-25H2,1-3H3;1H3/q+1;.
What are the key properties of amino(trioctyl)phosphanium;methyl trifluoromethanesulfonate?
amino(trioctyl)phosphanium;methyl trifluoromethanesulfonate has a molecular weight of 550.77 g/mol, XLogP of 9.44, 22 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for amino(trioctyl)phosphanium;methyl trifluoromethanesulfonate is sourced from PubChem (CID 174815242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).