About 1-fluorononyl trifluoromethanesulfonate
1-fluorononyl trifluoromethanesulfonate (PubChem CID 122369701) has the molecular formula C10H18F4O3S
and a molecular weight of 294.31 g/mol. Its IUPAC name is 1-fluorononyl trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 1-fluorononyl trifluoromethanesulfonate |
| PubChem CID | 122369701 |
| Molecular Formula | C10H18F4O3S |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 1-fluorononyl trifluoromethanesulfonate |
| SMILES | CCCCCCCCC(F)OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H18F4O3S/c1-2-3-4-5-6-7-8-9(11)17-18(15,16)10(12,13)14/h9H,2-8H2,1H3 |
| InChIKey | ZUHDINSYYMVOLL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 1-fluorononyl trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluorononyl trifluoromethanesulfonate?
The IUPAC name of 1-fluorononyl trifluoromethanesulfonate (CID 122369701) is 1-fluorononyl trifluoromethanesulfonate.
What is the SMILES notation for 1-fluorononyl trifluoromethanesulfonate?
The canonical SMILES for 1-fluorononyl trifluoromethanesulfonate is CCCCCCCCC(F)OS(=O)(=O)C(F)(F)F.
What is the InChIKey of 1-fluorononyl trifluoromethanesulfonate?
The InChIKey is ZUHDINSYYMVOLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F4O3S/c1-2-3-4-5-6-7-8-9(11)17-18(15,16)10(12,13)14/h9H,2-8H2,1H3.
What are the key properties of 1-fluorononyl trifluoromethanesulfonate?
1-fluorononyl trifluoromethanesulfonate has a molecular weight of 294.31 g/mol, XLogP of 3.90, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluorononyl trifluoromethanesulfonate is sourced from PubChem (CID 122369701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).