C15H13F16IO3S — CID 162397467
(9,9,10,10,11,11,12,12,13,13,14,14,14-tridecafluoro-7-iodotetradec-7-en-6-yl) trifluoromethanesulfonate (PubChem CID 162397467) has the molecular formula C15H13F16IO3S and a molecular weight of 704.20 g/mol. Its IUPAC name is (9,9,10,10,11,11,12,12,13,13,14,14,14-tridecafluoro-7-iodotetradec-7-en-6-yl) trifluoromethanesulfonate.
| Compound Name | (9,9,10,10,11,11,12,12,13,13,14,14,14-tridecafluoro-7-iodotetradec-7-en-6-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 162397467 |
| Molecular Formula | C15H13F16IO3S |
| Molecular Weight | 704.20 g/mol |
| Exact Mass | 703.94 |
| IUPAC Name | (9,9,10,10,11,11,12,12,13,13,14,14,14-tridecafluoro-7-iodotetradec-7-en-6-yl) trifluoromethanesulfonate |
| SMILES | CCCCCC(OS(=O)(=O)C(F)(F)F)C(I)=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H13F16IO3S/c1-2-3-4-5-8(35-36(33,34)15(29,30)31)7(32)6-9(16,17)10(18,19)11(20,21)12(22,23)13(24,25)14(26,27)28/h6,8H,2-5H2,1H3 |
| InChIKey | DIWXGZAOLDOKAI-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.20 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|